C20H23FN2O2S2 — CID 8744694
N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-1-(thiophene-2-carbonyl)piperidine-4-carboxamide (PubChem CID 8744694) has the molecular formula C20H23FN2O2S2 and a molecular weight of 406.55 g/mol. Its IUPAC name is N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-1-(thiophene-2-carbonyl)piperidine-4-carboxamide.
| Compound Name | N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-1-(thiophene-2-carbonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 8744694 |
| Molecular Formula | C20H23FN2O2S2 |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-1-(thiophene-2-carbonyl)piperidine-4-carboxamide |
| SMILES | O=C(NCCSCc1ccccc1F)C1CCN(C(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C20H23FN2O2S2/c21-17-5-2-1-4-16(17)14-26-13-9-22-19(24)15-7-10-23(11-8-15)20(25)18-6-3-12-27-18/h1-6,12,15H,7-11,13-14H2,(H,22,24) |
| InChIKey | KNXVNUQLFDUYEZ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|