C25H33ClN2O4S — CID 133254205
N-[2-(2-tert-butylphenoxy)ethyl]-1-[(3-chlorophenyl)methylsulfonyl]piperidine-3-carboxamide (PubChem CID 133254205) has the molecular formula C25H33ClN2O4S and a molecular weight of 493.07 g/mol. Its IUPAC name is N-[2-(2-tert-butylphenoxy)ethyl]-1-[(3-chlorophenyl)methylsulfonyl]piperidine-3-carboxamide.
| Compound Name | N-[2-(2-tert-butylphenoxy)ethyl]-1-[(3-chlorophenyl)methylsulfonyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 133254205 |
| Molecular Formula | C25H33ClN2O4S |
| Molecular Weight | 493.07 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | N-[2-(2-tert-butylphenoxy)ethyl]-1-[(3-chlorophenyl)methylsulfonyl]piperidine-3-carboxamide |
| SMILES | CC(C)(C)c1ccccc1OCCNC(=O)C1CCCN(S(=O)(=O)Cc2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C25H33ClN2O4S/c1-25(2,3)22-11-4-5-12-23(22)32-15-13-27-24(29)20-9-7-14-28(17-20)33(30,31)18-19-8-6-10-21(26)16-19/h4-6,8,10-12,16,20H,7,9,13-15,17-18H2,1-3H3,(H,27,29) |
| InChIKey | ZGAHGBPHGRVNRF-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.07 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|