C19H29ClN2O3S2 — CID 92641778
(3S)-N-(2-tert-butylsulfanylethyl)-1-[(3-chlorophenyl)methylsulfonyl]piperidine-3-carboxamide (PubChem CID 92641778) has the molecular formula C19H29ClN2O3S2 and a molecular weight of 433.04 g/mol. Its IUPAC name is (3S)-N-(2-tert-butylsulfanylethyl)-1-[(3-chlorophenyl)methylsulfonyl]piperidine-3-carboxamide.
| Compound Name | (3S)-N-(2-tert-butylsulfanylethyl)-1-[(3-chlorophenyl)methylsulfonyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 92641778 |
| Molecular Formula | C19H29ClN2O3S2 |
| Molecular Weight | 433.04 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | (3S)-N-(2-tert-butylsulfanylethyl)-1-[(3-chlorophenyl)methylsulfonyl]piperidine-3-carboxamide |
| SMILES | CC(C)(C)SCCNC(=O)[C@H]1CCCN(S(=O)(=O)Cc2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C19H29ClN2O3S2/c1-19(2,3)26-11-9-21-18(23)16-7-5-10-22(13-16)27(24,25)14-15-6-4-8-17(20)12-15/h4,6,8,12,16H,5,7,9-11,13-14H2,1-3H3,(H,21,23)/t16-/m0/s1 |
| InChIKey | QDWJOOLEZZLJFM-INIZCTEOSA-N |
| XLogP | 3.53 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.04 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|