C20H30ClN3O4S — CID 92641834
(3R)-1-[(3-chlorophenyl)methylsulfonyl]-N-(3-morpholin-4-ylpropyl)piperidine-3-carboxamide (PubChem CID 92641834) has the molecular formula C20H30ClN3O4S and a molecular weight of 444.00 g/mol. Its IUPAC name is (3R)-1-[(3-chlorophenyl)methylsulfonyl]-N-(3-morpholin-4-ylpropyl)piperidine-3-carboxamide.
| Compound Name | (3R)-1-[(3-chlorophenyl)methylsulfonyl]-N-(3-morpholin-4-ylpropyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 92641834 |
| Molecular Formula | C20H30ClN3O4S |
| Molecular Weight | 444.00 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | (3R)-1-[(3-chlorophenyl)methylsulfonyl]-N-(3-morpholin-4-ylpropyl)piperidine-3-carboxamide |
| SMILES | O=C(NCCCN1CCOCC1)[C@@H]1CCCN(S(=O)(=O)Cc2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C20H30ClN3O4S/c21-19-6-1-4-17(14-19)16-29(26,27)24-9-2-5-18(15-24)20(25)22-7-3-8-23-10-12-28-13-11-23/h1,4,6,14,18H,2-3,5,7-13,15-16H2,(H,22,25)/t18-/m1/s1 |
| InChIKey | AJWITZYPJZNZAC-GOSISDBHSA-N |
| XLogP | 1.72 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.00 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|