C19H29ClN2OS — CID 43922745
N-(2-tert-butylsulfanylethyl)-1-[(3-chlorophenyl)methyl]piperidine-3-carboxamide (PubChem CID 43922745) has the molecular formula C19H29ClN2OS and a molecular weight of 368.97 g/mol. Its IUPAC name is N-(2-tert-butylsulfanylethyl)-1-[(3-chlorophenyl)methyl]piperidine-3-carboxamide.
| Compound Name | N-(2-tert-butylsulfanylethyl)-1-[(3-chlorophenyl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 43922745 |
| Molecular Formula | C19H29ClN2OS |
| Molecular Weight | 368.97 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | N-(2-tert-butylsulfanylethyl)-1-[(3-chlorophenyl)methyl]piperidine-3-carboxamide |
| SMILES | CC(C)(C)SCCNC(=O)C1CCCN(Cc2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C19H29ClN2OS/c1-19(2,3)24-11-9-21-18(23)16-7-5-10-22(14-16)13-15-6-4-8-17(20)12-15/h4,6,8,12,16H,5,7,9-11,13-14H2,1-3H3,(H,21,23) |
| InChIKey | SBERYRGMFQNCSF-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.97 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|