C19H28Cl2N2OS — CID 43922756
N-(2-tert-butylsulfanylethyl)-1-[(3,4-dichlorophenyl)methyl]piperidine-4-carboxamide (PubChem CID 43922756) has the molecular formula C19H28Cl2N2OS and a molecular weight of 403.42 g/mol. Its IUPAC name is N-(2-tert-butylsulfanylethyl)-1-[(3,4-dichlorophenyl)methyl]piperidine-4-carboxamide.
| Compound Name | N-(2-tert-butylsulfanylethyl)-1-[(3,4-dichlorophenyl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 43922756 |
| Molecular Formula | C19H28Cl2N2OS |
| Molecular Weight | 403.42 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | N-(2-tert-butylsulfanylethyl)-1-[(3,4-dichlorophenyl)methyl]piperidine-4-carboxamide |
| SMILES | CC(C)(C)SCCNC(=O)C1CCN(Cc2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C19H28Cl2N2OS/c1-19(2,3)25-11-8-22-18(24)15-6-9-23(10-7-15)13-14-4-5-16(20)17(21)12-14/h4-5,12,15H,6-11,13H2,1-3H3,(H,22,24) |
| InChIKey | DPTLJIPLVLCEOK-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.42 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|