C22H24Cl4N2OS — CID 43922594
1-[(3,4-dichlorophenyl)methyl]-N-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]piperidine-4-carboxamide (PubChem CID 43922594) has the molecular formula C22H24Cl4N2OS and a molecular weight of 506.33 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]-N-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]piperidine-4-carboxamide.
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]-N-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 43922594 |
| Molecular Formula | C22H24Cl4N2OS |
| Molecular Weight | 506.33 g/mol |
| Exact Mass | 504.04 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]-N-[2-[(2,4-dichlorophenyl)methylsulfanyl]ethyl]piperidine-4-carboxamide |
| SMILES | O=C(NCCSCc1ccc(Cl)cc1Cl)C1CCN(Cc2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C22H24Cl4N2OS/c23-18-3-2-17(20(25)12-18)14-30-10-7-27-22(29)16-5-8-28(9-6-16)13-15-1-4-19(24)21(26)11-15/h1-4,11-12,16H,5-10,13-14H2,(H,27,29) |
| InChIKey | UPFWDCDLGOQFQW-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.33 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|