C22H25BrCl2N2OS — CID 43923018
1-[(4-bromophenyl)methyl]-N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]piperidine-4-carboxamide (PubChem CID 43923018) has the molecular formula C22H25BrCl2N2OS and a molecular weight of 516.33 g/mol. Its IUPAC name is 1-[(4-bromophenyl)methyl]-N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]piperidine-4-carboxamide.
| Compound Name | 1-[(4-bromophenyl)methyl]-N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 43923018 |
| Molecular Formula | C22H25BrCl2N2OS |
| Molecular Weight | 516.33 g/mol |
| Exact Mass | 514.02 |
| IUPAC Name | 1-[(4-bromophenyl)methyl]-N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]piperidine-4-carboxamide |
| SMILES | O=C(NCCSCc1c(Cl)cccc1Cl)C1CCN(Cc2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C22H25BrCl2N2OS/c23-18-6-4-16(5-7-18)14-27-11-8-17(9-12-27)22(28)26-10-13-29-15-19-20(24)2-1-3-21(19)25/h1-7,17H,8-15H2,(H,26,28) |
| InChIKey | RPGVNFXNUHSWCN-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.33 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|