C23H29BrN2OS — CID 43922978
1-[(4-bromophenyl)methyl]-N-[2-[(2-methylphenyl)methylsulfanyl]ethyl]piperidine-4-carboxamide (PubChem CID 43922978) has the molecular formula C23H29BrN2OS and a molecular weight of 461.47 g/mol. Its IUPAC name is 1-[(4-bromophenyl)methyl]-N-[2-[(2-methylphenyl)methylsulfanyl]ethyl]piperidine-4-carboxamide.
| Compound Name | 1-[(4-bromophenyl)methyl]-N-[2-[(2-methylphenyl)methylsulfanyl]ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 43922978 |
| Molecular Formula | C23H29BrN2OS |
| Molecular Weight | 461.47 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | 1-[(4-bromophenyl)methyl]-N-[2-[(2-methylphenyl)methylsulfanyl]ethyl]piperidine-4-carboxamide |
| SMILES | Cc1ccccc1CSCCNC(=O)C1CCN(Cc2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C23H29BrN2OS/c1-18-4-2-3-5-21(18)17-28-15-12-25-23(27)20-10-13-26(14-11-20)16-19-6-8-22(24)9-7-19/h2-9,20H,10-17H2,1H3,(H,25,27) |
| InChIKey | WSBMYPWILBRWCZ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.47 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|