C22H27BrN2OS — CID 43920681
1-[(4-bromophenyl)methyl]-N-[2-(4-methylphenyl)sulfanylethyl]piperidine-4-carboxamide (PubChem CID 43920681) has the molecular formula C22H27BrN2OS and a molecular weight of 447.44 g/mol. Its IUPAC name is 1-[(4-bromophenyl)methyl]-N-[2-(4-methylphenyl)sulfanylethyl]piperidine-4-carboxamide.
| Compound Name | 1-[(4-bromophenyl)methyl]-N-[2-(4-methylphenyl)sulfanylethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 43920681 |
| Molecular Formula | C22H27BrN2OS |
| Molecular Weight | 447.44 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | 1-[(4-bromophenyl)methyl]-N-[2-(4-methylphenyl)sulfanylethyl]piperidine-4-carboxamide |
| SMILES | Cc1ccc(SCCNC(=O)C2CCN(Cc3ccc(Br)cc3)CC2)cc1 |
| InChI | InChI=1S/C22H27BrN2OS/c1-17-2-8-21(9-3-17)27-15-12-24-22(26)19-10-13-25(14-11-19)16-18-4-6-20(23)7-5-18/h2-9,19H,10-16H2,1H3,(H,24,26) |
| InChIKey | LLPHRIKGNCSDIA-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.44 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|