C24H32N2OS — CID 45009188
1-[(3-methylphenyl)methyl]-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]piperidine-4-carboxamide (PubChem CID 45009188) has the molecular formula C24H32N2OS and a molecular weight of 396.60 g/mol. Its IUPAC name is 1-[(3-methylphenyl)methyl]-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]piperidine-4-carboxamide.
| Compound Name | 1-[(3-methylphenyl)methyl]-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 45009188 |
| Molecular Formula | C24H32N2OS |
| Molecular Weight | 396.60 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | 1-[(3-methylphenyl)methyl]-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]piperidine-4-carboxamide |
| SMILES | Cc1ccc(CSCCNC(=O)C2CCN(Cc3cccc(C)c3)CC2)cc1 |
| InChI | InChI=1S/C24H32N2OS/c1-19-6-8-21(9-7-19)18-28-15-12-25-24(27)23-10-13-26(14-11-23)17-22-5-3-4-20(2)16-22/h3-9,16,23H,10-15,17-18H2,1-2H3,(H,25,27) |
| InChIKey | CXWYMTCCOSFYQQ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.60 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|