C25H32N2O2S — CID 55633459
N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]-1-(3-phenylpropanoyl)piperidine-4-carboxamide (PubChem CID 55633459) has the molecular formula C25H32N2O2S and a molecular weight of 424.61 g/mol. Its IUPAC name is N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]-1-(3-phenylpropanoyl)piperidine-4-carboxamide.
| Compound Name | N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]-1-(3-phenylpropanoyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55633459 |
| Molecular Formula | C25H32N2O2S |
| Molecular Weight | 424.61 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]-1-(3-phenylpropanoyl)piperidine-4-carboxamide |
| SMILES | Cc1ccc(CSCCNC(=O)C2CCN(C(=O)CCc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C25H32N2O2S/c1-20-7-9-22(10-8-20)19-30-18-15-26-25(29)23-13-16-27(17-14-23)24(28)12-11-21-5-3-2-4-6-21/h2-10,23H,11-19H2,1H3,(H,26,29) |
| InChIKey | ZEMRVYWIQVHKKW-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.61 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|