C23H27N3O3S2 — CID 27708214
1-(1,1-dioxo-1,2-benzothiazol-3-yl)-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]piperidine-4-carboxamide (PubChem CID 27708214) has the molecular formula C23H27N3O3S2 and a molecular weight of 457.62 g/mol. Its IUPAC name is 1-(1,1-dioxo-1,2-benzothiazol-3-yl)-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]piperidine-4-carboxamide.
| Compound Name | 1-(1,1-dioxo-1,2-benzothiazol-3-yl)-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 27708214 |
| Molecular Formula | C23H27N3O3S2 |
| Molecular Weight | 457.62 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | 1-(1,1-dioxo-1,2-benzothiazol-3-yl)-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]piperidine-4-carboxamide |
| SMILES | Cc1ccc(CSCCNC(=O)C2CCN(C3=NS(=O)(=O)c4ccccc43)CC2)cc1 |
| InChI | InChI=1S/C23H27N3O3S2/c1-17-6-8-18(9-7-17)16-30-15-12-24-23(27)19-10-13-26(14-11-19)22-20-4-2-3-5-21(20)31(28,29)25-22/h2-9,19H,10-16H2,1H3,(H,24,27) |
| InChIKey | LAZBSMXTRIWAGW-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.62 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|