C22H25N3O3S2 — CID 31425010
(2S)-1-(1,1-dioxo-1,2-benzothiazol-3-yl)-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]pyrrolidine-2-carboxamide (PubChem CID 31425010) has the molecular formula C22H25N3O3S2 and a molecular weight of 443.59 g/mol. Its IUPAC name is (2S)-1-(1,1-dioxo-1,2-benzothiazol-3-yl)-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-(1,1-dioxo-1,2-benzothiazol-3-yl)-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 31425010 |
| Molecular Formula | C22H25N3O3S2 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | (2S)-1-(1,1-dioxo-1,2-benzothiazol-3-yl)-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]pyrrolidine-2-carboxamide |
| SMILES | Cc1ccc(CSCCNC(=O)[C@@H]2CCCN2C2=NS(=O)(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C22H25N3O3S2/c1-16-8-10-17(11-9-16)15-29-14-12-23-22(26)19-6-4-13-25(19)21-18-5-2-3-7-20(18)30(27,28)24-21/h2-3,5,7-11,19H,4,6,12-15H2,1H3,(H,23,26)/t19-/m0/s1 |
| InChIKey | KPEIVCRBJKDIRE-IBGZPJMESA-N |
| XLogP | 2.96 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|