C23H30N2OS — CID 45010994
1-[(3-methylphenyl)methyl]-N-[2-(4-methylphenyl)sulfanylethyl]piperidine-4-carboxamide (PubChem CID 45010994) has the molecular formula C23H30N2OS and a molecular weight of 382.57 g/mol. Its IUPAC name is 1-[(3-methylphenyl)methyl]-N-[2-(4-methylphenyl)sulfanylethyl]piperidine-4-carboxamide.
| Compound Name | 1-[(3-methylphenyl)methyl]-N-[2-(4-methylphenyl)sulfanylethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 45010994 |
| Molecular Formula | C23H30N2OS |
| Molecular Weight | 382.57 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | 1-[(3-methylphenyl)methyl]-N-[2-(4-methylphenyl)sulfanylethyl]piperidine-4-carboxamide |
| SMILES | Cc1ccc(SCCNC(=O)C2CCN(Cc3cccc(C)c3)CC2)cc1 |
| InChI | InChI=1S/C23H30N2OS/c1-18-6-8-22(9-7-18)27-15-12-24-23(26)21-10-13-25(14-11-21)17-20-5-3-4-19(2)16-20/h3-9,16,21H,10-15,17H2,1-2H3,(H,24,26) |
| InChIKey | FNCDOVZGGJBRJC-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.57 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|