C23H28Cl2N2O — CID 46774026
1-[(2,6-dichlorophenyl)methyl]-N-[3-(3-methylphenyl)propyl]piperidine-4-carboxamide (PubChem CID 46774026) has the molecular formula C23H28Cl2N2O and a molecular weight of 419.40 g/mol. Its IUPAC name is 1-[(2,6-dichlorophenyl)methyl]-N-[3-(3-methylphenyl)propyl]piperidine-4-carboxamide.
| Compound Name | 1-[(2,6-dichlorophenyl)methyl]-N-[3-(3-methylphenyl)propyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 46774026 |
| Molecular Formula | C23H28Cl2N2O |
| Molecular Weight | 419.40 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | 1-[(2,6-dichlorophenyl)methyl]-N-[3-(3-methylphenyl)propyl]piperidine-4-carboxamide |
| SMILES | Cc1cccc(CCCNC(=O)C2CCN(Cc3c(Cl)cccc3Cl)CC2)c1 |
| InChI | InChI=1S/C23H28Cl2N2O/c1-17-5-2-6-18(15-17)7-4-12-26-23(28)19-10-13-27(14-11-19)16-20-21(24)8-3-9-22(20)25/h2-3,5-6,8-9,15,19H,4,7,10-14,16H2,1H3,(H,26,28) |
| InChIKey | WYCFBTBVZMNNFQ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.40 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|