C25H29ClN4O2 — CID 38140582
N-[3-(2-chlorophenyl)propyl]-1-[[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]piperidine-4-carboxamide (PubChem CID 38140582) has the molecular formula C25H29ClN4O2 and a molecular weight of 452.99 g/mol. Its IUPAC name is N-[3-(2-chlorophenyl)propyl]-1-[[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]piperidine-4-carboxamide.
| Compound Name | N-[3-(2-chlorophenyl)propyl]-1-[[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 38140582 |
| Molecular Formula | C25H29ClN4O2 |
| Molecular Weight | 452.99 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | N-[3-(2-chlorophenyl)propyl]-1-[[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]piperidine-4-carboxamide |
| SMILES | Cc1cccc(-c2noc(CN3CCC(C(=O)NCCCc4ccccc4Cl)CC3)n2)c1 |
| InChI | InChI=1S/C25H29ClN4O2/c1-18-6-4-8-21(16-18)24-28-23(32-29-24)17-30-14-11-20(12-15-30)25(31)27-13-5-9-19-7-2-3-10-22(19)26/h2-4,6-8,10,16,20H,5,9,11-15,17H2,1H3,(H,27,31) |
| InChIKey | VOOIPJLAUZQFMY-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.99 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|