C24H33ClN4O2S — CID 38156424
1-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-(3-cyclohexylsulfanylpropyl)piperidine-4-carboxamide (PubChem CID 38156424) has the molecular formula C24H33ClN4O2S and a molecular weight of 477.07 g/mol. Its IUPAC name is 1-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-(3-cyclohexylsulfanylpropyl)piperidine-4-carboxamide.
| Compound Name | 1-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-(3-cyclohexylsulfanylpropyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 38156424 |
| Molecular Formula | C24H33ClN4O2S |
| Molecular Weight | 477.07 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | 1-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-(3-cyclohexylsulfanylpropyl)piperidine-4-carboxamide |
| SMILES | O=C(NCCCSC1CCCCC1)C1CCN(Cc2nc(-c3cccc(Cl)c3)no2)CC1 |
| InChI | InChI=1S/C24H33ClN4O2S/c25-20-7-4-6-19(16-20)23-27-22(31-28-23)17-29-13-10-18(11-14-29)24(30)26-12-5-15-32-21-8-2-1-3-9-21/h4,6-7,16,18,21H,1-3,5,8-15,17H2,(H,26,30) |
| InChIKey | NYPZRQZGROYWFQ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.07 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|