C23H31BrN4O2S — CID 38147532
1-[[3-(4-bromophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-(2-cyclohexylsulfanylethyl)piperidine-4-carboxamide (PubChem CID 38147532) has the molecular formula C23H31BrN4O2S and a molecular weight of 507.50 g/mol. Its IUPAC name is 1-[[3-(4-bromophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-(2-cyclohexylsulfanylethyl)piperidine-4-carboxamide.
| Compound Name | 1-[[3-(4-bromophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-(2-cyclohexylsulfanylethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 38147532 |
| Molecular Formula | C23H31BrN4O2S |
| Molecular Weight | 507.50 g/mol |
| Exact Mass | 506.14 |
| IUPAC Name | 1-[[3-(4-bromophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-(2-cyclohexylsulfanylethyl)piperidine-4-carboxamide |
| SMILES | O=C(NCCSC1CCCCC1)C1CCN(Cc2nc(-c3ccc(Br)cc3)no2)CC1 |
| InChI | InChI=1S/C23H31BrN4O2S/c24-19-8-6-17(7-9-19)22-26-21(30-27-22)16-28-13-10-18(11-14-28)23(29)25-12-15-31-20-4-2-1-3-5-20/h6-9,18,20H,1-5,10-16H2,(H,25,29) |
| InChIKey | DHKXSALOGAMODL-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.50 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|