C24H33FN4O2S — CID 38152792
N-(3-cyclohexylsulfanylpropyl)-1-[[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl]piperidine-4-carboxamide (PubChem CID 38152792) has the molecular formula C24H33FN4O2S and a molecular weight of 460.62 g/mol. Its IUPAC name is N-(3-cyclohexylsulfanylpropyl)-1-[[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl]piperidine-4-carboxamide.
| Compound Name | N-(3-cyclohexylsulfanylpropyl)-1-[[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 38152792 |
| Molecular Formula | C24H33FN4O2S |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.23 |
| IUPAC Name | N-(3-cyclohexylsulfanylpropyl)-1-[[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl]piperidine-4-carboxamide |
| SMILES | O=C(NCCCSC1CCCCC1)C1CCN(Cc2nc(-c3ccc(F)cc3)no2)CC1 |
| InChI | InChI=1S/C24H33FN4O2S/c25-20-9-7-18(8-10-20)23-27-22(31-28-23)17-29-14-11-19(12-15-29)24(30)26-13-4-16-32-21-5-2-1-3-6-21/h7-10,19,21H,1-6,11-17H2,(H,26,30) |
| InChIKey | BDAFLWICOZFSDZ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|