C18H23FN4O3 — CID 33083933
1-[[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-(2-methoxyethyl)piperidine-4-carboxamide (PubChem CID 33083933) has the molecular formula C18H23FN4O3 and a molecular weight of 362.41 g/mol. Its IUPAC name is 1-[[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-(2-methoxyethyl)piperidine-4-carboxamide.
| Compound Name | 1-[[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-(2-methoxyethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 33083933 |
| Molecular Formula | C18H23FN4O3 |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | 1-[[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-(2-methoxyethyl)piperidine-4-carboxamide |
| SMILES | COCCNC(=O)C1CCN(Cc2nc(-c3ccc(F)cc3)no2)CC1 |
| InChI | InChI=1S/C18H23FN4O3/c1-25-11-8-20-18(24)14-6-9-23(10-7-14)12-16-21-17(22-26-16)13-2-4-15(19)5-3-13/h2-5,14H,6-12H2,1H3,(H,20,24) |
| InChIKey | QPQDIRJVFIELQL-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 80.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|