C20H27FN4O2 — CID 38152040
1-[[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-pentylpiperidine-4-carboxamide (PubChem CID 38152040) has the molecular formula C20H27FN4O2 and a molecular weight of 374.46 g/mol. Its IUPAC name is 1-[[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-pentylpiperidine-4-carboxamide.
| Compound Name | 1-[[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-pentylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 38152040 |
| Molecular Formula | C20H27FN4O2 |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | 1-[[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-pentylpiperidine-4-carboxamide |
| SMILES | CCCCCNC(=O)C1CCN(Cc2nc(-c3ccc(F)cc3)no2)CC1 |
| InChI | InChI=1S/C20H27FN4O2/c1-2-3-4-11-22-20(26)16-9-12-25(13-10-16)14-18-23-19(24-27-18)15-5-7-17(21)8-6-15/h5-8,16H,2-4,9-14H2,1H3,(H,22,26) |
| InChIKey | LIHPWASDFIRPEB-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|