C23H29ClN2O3S — CID 99951535
1-[(3-chlorophenyl)methylsulfonyl]-N-[3-(3-methylphenyl)propyl]piperidine-4-carboxamide (PubChem CID 99951535) has the molecular formula C23H29ClN2O3S and a molecular weight of 449.02 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methylsulfonyl]-N-[3-(3-methylphenyl)propyl]piperidine-4-carboxamide.
| Compound Name | 1-[(3-chlorophenyl)methylsulfonyl]-N-[3-(3-methylphenyl)propyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 99951535 |
| Molecular Formula | C23H29ClN2O3S |
| Molecular Weight | 449.02 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | 1-[(3-chlorophenyl)methylsulfonyl]-N-[3-(3-methylphenyl)propyl]piperidine-4-carboxamide |
| SMILES | Cc1cccc(CCCNC(=O)C2CCN(S(=O)(=O)Cc3cccc(Cl)c3)CC2)c1 |
| InChI | InChI=1S/C23H29ClN2O3S/c1-18-5-2-6-19(15-18)8-4-12-25-23(27)21-10-13-26(14-11-21)30(28,29)17-20-7-3-9-22(24)16-20/h2-3,5-7,9,15-16,21H,4,8,10-14,17H2,1H3,(H,25,27) |
| InChIKey | TVDNPGXTZIKDFL-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.02 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|