C24H39N3O3S — CID 99949522
N-[3-[(3S,5S)-3,5-dimethylpiperidin-1-yl]propyl]-1-[(3-methylphenyl)methylsulfonyl]piperidine-4-carboxamide (PubChem CID 99949522) has the molecular formula C24H39N3O3S and a molecular weight of 449.66 g/mol. Its IUPAC name is N-[3-[(3S,5S)-3,5-dimethylpiperidin-1-yl]propyl]-1-[(3-methylphenyl)methylsulfonyl]piperidine-4-carboxamide.
| Compound Name | N-[3-[(3S,5S)-3,5-dimethylpiperidin-1-yl]propyl]-1-[(3-methylphenyl)methylsulfonyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 99949522 |
| Molecular Formula | C24H39N3O3S |
| Molecular Weight | 449.66 g/mol |
| Exact Mass | 449.27 |
| IUPAC Name | N-[3-[(3S,5S)-3,5-dimethylpiperidin-1-yl]propyl]-1-[(3-methylphenyl)methylsulfonyl]piperidine-4-carboxamide |
| SMILES | Cc1cccc(CS(=O)(=O)N2CCC(C(=O)NCCCN3C[C@@H](C)C[C@H](C)C3)CC2)c1 |
| InChI | InChI=1S/C24H39N3O3S/c1-19-6-4-7-22(15-19)18-31(29,30)27-12-8-23(9-13-27)24(28)25-10-5-11-26-16-20(2)14-21(3)17-26/h4,6-7,15,20-21,23H,5,8-14,16-18H2,1-3H3,(H,25,28)/t20-,21-/m0/s1 |
| InChIKey | BGTATPUVDXEKNH-SFTDATJTSA-N |
| XLogP | 3.02 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.66 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|