C23H35Cl2N3O3S — CID 28567688
1-[(3,4-dichlorophenyl)methylsulfonyl]-N-[3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propyl]piperidine-4-carboxamide (PubChem CID 28567688) has the molecular formula C23H35Cl2N3O3S and a molecular weight of 504.52 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methylsulfonyl]-N-[3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propyl]piperidine-4-carboxamide.
| Compound Name | 1-[(3,4-dichlorophenyl)methylsulfonyl]-N-[3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 28567688 |
| Molecular Formula | C23H35Cl2N3O3S |
| Molecular Weight | 504.52 g/mol |
| Exact Mass | 503.18 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methylsulfonyl]-N-[3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propyl]piperidine-4-carboxamide |
| SMILES | C[C@@H]1C[C@@H](C)CN(CCCNC(=O)C2CCN(S(=O)(=O)Cc3ccc(Cl)c(Cl)c3)CC2)C1 |
| InChI | InChI=1S/C23H35Cl2N3O3S/c1-17-12-18(2)15-27(14-17)9-3-8-26-23(29)20-6-10-28(11-7-20)32(30,31)16-19-4-5-21(24)22(25)13-19/h4-5,13,17-18,20H,3,6-12,14-16H2,1-2H3,(H,26,29)/t17-,18-/m1/s1 |
| InChIKey | MPIURHJKJGMHQV-QZTJIDSGSA-N |
| XLogP | 4.02 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.52 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|