C22H26Cl2N2O3S — CID 133164298
1-[(3,4-dichlorophenyl)methylsulfonyl]-N-(2-phenylpropyl)piperidine-4-carboxamide (PubChem CID 133164298) has the molecular formula C22H26Cl2N2O3S and a molecular weight of 469.43 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methylsulfonyl]-N-(2-phenylpropyl)piperidine-4-carboxamide.
| Compound Name | 1-[(3,4-dichlorophenyl)methylsulfonyl]-N-(2-phenylpropyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 133164298 |
| Molecular Formula | C22H26Cl2N2O3S |
| Molecular Weight | 469.43 g/mol |
| Exact Mass | 468.10 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methylsulfonyl]-N-(2-phenylpropyl)piperidine-4-carboxamide |
| SMILES | CC(CNC(=O)C1CCN(S(=O)(=O)Cc2ccc(Cl)c(Cl)c2)CC1)c1ccccc1 |
| InChI | InChI=1S/C22H26Cl2N2O3S/c1-16(18-5-3-2-4-6-18)14-25-22(27)19-9-11-26(12-10-19)30(28,29)15-17-7-8-20(23)21(24)13-17/h2-8,13,16,19H,9-12,14-15H2,1H3,(H,25,27) |
| InChIKey | SPBVGSHGJWFTRK-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.43 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |