C24H31ClN2O3S — CID 43885252
1-[(3-chlorophenyl)methylsulfonyl]-N-(3-methyl-1-phenylbutyl)piperidine-4-carboxamide (PubChem CID 43885252) has the molecular formula C24H31ClN2O3S and a molecular weight of 463.04 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methylsulfonyl]-N-(3-methyl-1-phenylbutyl)piperidine-4-carboxamide.
| Compound Name | 1-[(3-chlorophenyl)methylsulfonyl]-N-(3-methyl-1-phenylbutyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 43885252 |
| Molecular Formula | C24H31ClN2O3S |
| Molecular Weight | 463.04 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | 1-[(3-chlorophenyl)methylsulfonyl]-N-(3-methyl-1-phenylbutyl)piperidine-4-carboxamide |
| SMILES | CC(C)CC(NC(=O)C1CCN(S(=O)(=O)Cc2cccc(Cl)c2)CC1)c1ccccc1 |
| InChI | InChI=1S/C24H31ClN2O3S/c1-18(2)15-23(20-8-4-3-5-9-20)26-24(28)21-11-13-27(14-12-21)31(29,30)17-19-7-6-10-22(25)16-19/h3-10,16,18,21,23H,11-15,17H2,1-2H3,(H,26,28) |
| InChIKey | GMHBFJMKVHAVRA-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.04 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |