C21H25ClN2O3S2 — CID 92671692
1-[(3-chlorophenyl)methylsulfonyl]-N-(2-ethylsulfanylphenyl)piperidine-4-carboxamide (PubChem CID 92671692) has the molecular formula C21H25ClN2O3S2 and a molecular weight of 453.03 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methylsulfonyl]-N-(2-ethylsulfanylphenyl)piperidine-4-carboxamide.
| Compound Name | 1-[(3-chlorophenyl)methylsulfonyl]-N-(2-ethylsulfanylphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 92671692 |
| Molecular Formula | C21H25ClN2O3S2 |
| Molecular Weight | 453.03 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | 1-[(3-chlorophenyl)methylsulfonyl]-N-(2-ethylsulfanylphenyl)piperidine-4-carboxamide |
| SMILES | CCSc1ccccc1NC(=O)C1CCN(S(=O)(=O)Cc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C21H25ClN2O3S2/c1-2-28-20-9-4-3-8-19(20)23-21(25)17-10-12-24(13-11-17)29(26,27)15-16-6-5-7-18(22)14-16/h3-9,14,17H,2,10-13,15H2,1H3,(H,23,25) |
| InChIKey | BJXUYUCLPAYSNI-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.03 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |