C23H30N2O3S2 — CID 28570527
N-(2-ethylsulfanylphenyl)-1-(3-phenylpropylsulfonyl)piperidine-4-carboxamide (PubChem CID 28570527) has the molecular formula C23H30N2O3S2 and a molecular weight of 446.64 g/mol. Its IUPAC name is N-(2-ethylsulfanylphenyl)-1-(3-phenylpropylsulfonyl)piperidine-4-carboxamide.
| Compound Name | N-(2-ethylsulfanylphenyl)-1-(3-phenylpropylsulfonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 28570527 |
| Molecular Formula | C23H30N2O3S2 |
| Molecular Weight | 446.64 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | N-(2-ethylsulfanylphenyl)-1-(3-phenylpropylsulfonyl)piperidine-4-carboxamide |
| SMILES | CCSc1ccccc1NC(=O)C1CCN(S(=O)(=O)CCCc2ccccc2)CC1 |
| InChI | InChI=1S/C23H30N2O3S2/c1-2-29-22-13-7-6-12-21(22)24-23(26)20-14-16-25(17-15-20)30(27,28)18-8-11-19-9-4-3-5-10-19/h3-7,9-10,12-13,20H,2,8,11,14-18H2,1H3,(H,24,26) |
| InChIKey | OCKQZONLNUOYPY-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.64 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |