C16H22N2O3S2 — CID 24603608
1-methylsulfonyl-N-(2-prop-2-enylsulfanylphenyl)piperidine-4-carboxamide (PubChem CID 24603608) has the molecular formula C16H22N2O3S2 and a molecular weight of 354.50 g/mol. Its IUPAC name is 1-methylsulfonyl-N-(2-prop-2-enylsulfanylphenyl)piperidine-4-carboxamide.
| Compound Name | 1-methylsulfonyl-N-(2-prop-2-enylsulfanylphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 24603608 |
| Molecular Formula | C16H22N2O3S2 |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | 1-methylsulfonyl-N-(2-prop-2-enylsulfanylphenyl)piperidine-4-carboxamide |
| SMILES | C=CCSc1ccccc1NC(=O)C1CCN(S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C16H22N2O3S2/c1-3-12-22-15-7-5-4-6-14(15)17-16(19)13-8-10-18(11-9-13)23(2,20)21/h3-7,13H,1,8-12H2,2H3,(H,17,19) |
| InChIKey | NTCMFAPLMSTZPK-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|