C22H25ClN4O2S — CID 55816126
N-(5-chloro-2-pyridinyl)-1-[2-oxo-2-(2-prop-2-enylsulfanylanilino)ethyl]piperidine-4-carboxamide (PubChem CID 55816126) has the molecular formula C22H25ClN4O2S and a molecular weight of 444.99 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-1-[2-oxo-2-(2-prop-2-enylsulfanylanilino)ethyl]piperidine-4-carboxamide.
| Compound Name | N-(5-chloro-2-pyridinyl)-1-[2-oxo-2-(2-prop-2-enylsulfanylanilino)ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55816126 |
| Molecular Formula | C22H25ClN4O2S |
| Molecular Weight | 444.99 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-1-[2-oxo-2-(2-prop-2-enylsulfanylanilino)ethyl]piperidine-4-carboxamide |
| SMILES | C=CCSc1ccccc1NC(=O)CN1CCC(C(=O)Nc2ccc(Cl)cn2)CC1 |
| InChI | InChI=1S/C22H25ClN4O2S/c1-2-13-30-19-6-4-3-5-18(19)25-21(28)15-27-11-9-16(10-12-27)22(29)26-20-8-7-17(23)14-24-20/h2-8,14,16H,1,9-13,15H2,(H,25,28)(H,24,26,29) |
| InChIKey | SVSAJCXTILCZSO-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.99 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|