C20H30N4O2S — CID 18088532
2-[4-[2-oxo-2-(2-prop-2-enylsulfanylanilino)ethyl]piperazin-1-yl]-N-propylacetamide (PubChem CID 18088532) has the molecular formula C20H30N4O2S and a molecular weight of 390.55 g/mol. Its IUPAC name is 2-[4-[2-oxo-2-(2-prop-2-enylsulfanylanilino)ethyl]piperazin-1-yl]-N-propylacetamide.
| Compound Name | 2-[4-[2-oxo-2-(2-prop-2-enylsulfanylanilino)ethyl]piperazin-1-yl]-N-propylacetamide |
|---|---|
| PubChem CID | 18088532 |
| Molecular Formula | C20H30N4O2S |
| Molecular Weight | 390.55 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | 2-[4-[2-oxo-2-(2-prop-2-enylsulfanylanilino)ethyl]piperazin-1-yl]-N-propylacetamide |
| SMILES | C=CCSc1ccccc1NC(=O)CN1CCN(CC(=O)NCCC)CC1 |
| InChI | InChI=1S/C20H30N4O2S/c1-3-9-21-19(25)15-23-10-12-24(13-11-23)16-20(26)22-17-7-5-6-8-18(17)27-14-4-2/h4-8H,2-3,9-16H2,1H3,(H,21,25)(H,22,26) |
| InChIKey | CFIAPYIWFQFFCN-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.55 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|