C23H28N2O2S — CID 42939544
2-[4-[hydroxy(phenyl)methyl]piperidin-1-yl]-N-(2-prop-2-enylsulfanylphenyl)acetamide (PubChem CID 42939544) has the molecular formula C23H28N2O2S and a molecular weight of 396.56 g/mol. Its IUPAC name is 2-[4-[hydroxy(phenyl)methyl]piperidin-1-yl]-N-(2-prop-2-enylsulfanylphenyl)acetamide.
| Compound Name | 2-[4-[hydroxy(phenyl)methyl]piperidin-1-yl]-N-(2-prop-2-enylsulfanylphenyl)acetamide |
|---|---|
| PubChem CID | 42939544 |
| Molecular Formula | C23H28N2O2S |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | 2-[4-[hydroxy(phenyl)methyl]piperidin-1-yl]-N-(2-prop-2-enylsulfanylphenyl)acetamide |
| SMILES | C=CCSc1ccccc1NC(=O)CN1CCC(C(O)c2ccccc2)CC1 |
| InChI | InChI=1S/C23H28N2O2S/c1-2-16-28-21-11-7-6-10-20(21)24-22(26)17-25-14-12-19(13-15-25)23(27)18-8-4-3-5-9-18/h2-11,19,23,27H,1,12-17H2,(H,24,26) |
| InChIKey | RJEWHSNDTXHRCV-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|