C20H23FN2O2 — CID 33350694
N-(3-fluorophenyl)-2-[4-[(S)-hydroxy(phenyl)methyl]piperidin-1-yl]acetamide (PubChem CID 33350694) has the molecular formula C20H23FN2O2 and a molecular weight of 342.41 g/mol. Its IUPAC name is N-(3-fluorophenyl)-2-[4-[(S)-hydroxy(phenyl)methyl]piperidin-1-yl]acetamide.
| Compound Name | N-(3-fluorophenyl)-2-[4-[(S)-hydroxy(phenyl)methyl]piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 33350694 |
| Molecular Formula | C20H23FN2O2 |
| Molecular Weight | 342.41 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | N-(3-fluorophenyl)-2-[4-[(S)-hydroxy(phenyl)methyl]piperidin-1-yl]acetamide |
| SMILES | O=C(CN1CCC([C@H](O)c2ccccc2)CC1)Nc1cccc(F)c1 |
| InChI | InChI=1S/C20H23FN2O2/c21-17-7-4-8-18(13-17)22-19(24)14-23-11-9-16(10-12-23)20(25)15-5-2-1-3-6-15/h1-8,13,16,20,25H,9-12,14H2,(H,22,24)/t20-/m1/s1 |
| InChIKey | NZHPRWXMLMYXCR-HXUWFJFHSA-N |
| XLogP | 3.21 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.41 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |