C16H25ClFN3O — CID 119928163
2-[4-(ethylaminomethyl)piperidin-1-yl]-N-(3-fluorophenyl)acetamide;hydrochloride (PubChem CID 119928163) has the molecular formula C16H25ClFN3O and a molecular weight of 329.85 g/mol. Its IUPAC name is 2-[4-(ethylaminomethyl)piperidin-1-yl]-N-(3-fluorophenyl)acetamide;hydrochloride.
| Compound Name | 2-[4-(ethylaminomethyl)piperidin-1-yl]-N-(3-fluorophenyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119928163 |
| Molecular Formula | C16H25ClFN3O |
| Molecular Weight | 329.85 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 2-[4-(ethylaminomethyl)piperidin-1-yl]-N-(3-fluorophenyl)acetamide;hydrochloride |
| SMILES | CCNCC1CCN(CC(=O)Nc2cccc(F)c2)CC1.Cl |
| InChI | InChI=1S/C16H24FN3O.ClH/c1-2-18-11-13-6-8-20(9-7-13)12-16(21)19-15-5-3-4-14(17)10-15;/h3-5,10,13,18H,2,6-9,11-12H2,1H3,(H,19,21);1H |
| InChIKey | AMKAJEZHIGFEAC-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.85 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |