C19H29N5O3 — CID 18284875
2-[[2-[4-[2-(butylamino)-2-oxoethyl]piperazin-1-yl]acetyl]amino]benzamide (PubChem CID 18284875) has the molecular formula C19H29N5O3 and a molecular weight of 375.47 g/mol. Its IUPAC name is 2-[[2-[4-[2-(butylamino)-2-oxoethyl]piperazin-1-yl]acetyl]amino]benzamide.
| Compound Name | 2-[[2-[4-[2-(butylamino)-2-oxoethyl]piperazin-1-yl]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 18284875 |
| Molecular Formula | C19H29N5O3 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | 2-[[2-[4-[2-(butylamino)-2-oxoethyl]piperazin-1-yl]acetyl]amino]benzamide |
| SMILES | CCCCNC(=O)CN1CCN(CC(=O)Nc2ccccc2C(N)=O)CC1 |
| InChI | InChI=1S/C19H29N5O3/c1-2-3-8-21-17(25)13-23-9-11-24(12-10-23)14-18(26)22-16-7-5-4-6-15(16)19(20)27/h4-7H,2-3,8-14H2,1H3,(H2,20,27)(H,21,25)(H,22,26) |
| InChIKey | YKBRBKGWKPIAPE-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|