C17H13N3O4 — CID 4692603
2-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]benzamide (PubChem CID 4692603) has the molecular formula C17H13N3O4 and a molecular weight of 323.31 g/mol. Its IUPAC name is 2-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]benzamide.
| Compound Name | 2-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 4692603 |
| Molecular Formula | C17H13N3O4 |
| Molecular Weight | 323.31 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 2-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]benzamide |
| SMILES | NC(=O)c1ccccc1NC(=O)CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C17H13N3O4/c18-15(22)12-7-3-4-8-13(12)19-14(21)9-20-16(23)10-5-1-2-6-11(10)17(20)24/h1-8H,9H2,(H2,18,22)(H,19,21) |
| InChIKey | YNRMNCOPBZOFJR-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.31 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|