C22H21N3O4 — CID 1223346
2-(1,3-dioxoisoindol-2-yl)-N-[2-(piperidine-1-carbonyl)phenyl]acetamide (PubChem CID 1223346) has the molecular formula C22H21N3O4 and a molecular weight of 391.43 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N-[2-(piperidine-1-carbonyl)phenyl]acetamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N-[2-(piperidine-1-carbonyl)phenyl]acetamide |
|---|---|
| PubChem CID | 1223346 |
| Molecular Formula | C22H21N3O4 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N-[2-(piperidine-1-carbonyl)phenyl]acetamide |
| SMILES | O=C(CN1C(=O)c2ccccc2C1=O)Nc1ccccc1C(=O)N1CCCCC1 |
| InChI | InChI=1S/C22H21N3O4/c26-19(14-25-21(28)15-8-2-3-9-16(15)22(25)29)23-18-11-5-4-10-17(18)20(27)24-12-6-1-7-13-24/h2-5,8-11H,1,6-7,12-14H2,(H,23,26) |
| InChIKey | YXXOMQCXBSODJH-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|