C21H26N4O2 — CID 55511052
2-[[2-(4-benzyl-1,4-diazepan-1-yl)acetyl]amino]benzamide (PubChem CID 55511052) has the molecular formula C21H26N4O2 and a molecular weight of 366.47 g/mol. Its IUPAC name is 2-[[2-(4-benzyl-1,4-diazepan-1-yl)acetyl]amino]benzamide.
| Compound Name | 2-[[2-(4-benzyl-1,4-diazepan-1-yl)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 55511052 |
| Molecular Formula | C21H26N4O2 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | 2-[[2-(4-benzyl-1,4-diazepan-1-yl)acetyl]amino]benzamide |
| SMILES | NC(=O)c1ccccc1NC(=O)CN1CCCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C21H26N4O2/c22-21(27)18-9-4-5-10-19(18)23-20(26)16-25-12-6-11-24(13-14-25)15-17-7-2-1-3-8-17/h1-5,7-10H,6,11-16H2,(H2,22,27)(H,23,26) |
| InChIKey | PIJONKGMZNRGEN-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |