C29H34N4O3 — CID 16618283
2-[[2-(4-benzyl-1,4-diazepan-1-yl)acetyl]amino]-N-(4-ethoxyphenyl)benzamide (PubChem CID 16618283) has the molecular formula C29H34N4O3 and a molecular weight of 486.62 g/mol. Its IUPAC name is 2-[[2-(4-benzyl-1,4-diazepan-1-yl)acetyl]amino]-N-(4-ethoxyphenyl)benzamide.
| Compound Name | 2-[[2-(4-benzyl-1,4-diazepan-1-yl)acetyl]amino]-N-(4-ethoxyphenyl)benzamide |
|---|---|
| PubChem CID | 16618283 |
| Molecular Formula | C29H34N4O3 |
| Molecular Weight | 486.62 g/mol |
| Exact Mass | 486.26 |
| IUPAC Name | 2-[[2-(4-benzyl-1,4-diazepan-1-yl)acetyl]amino]-N-(4-ethoxyphenyl)benzamide |
| SMILES | CCOc1ccc(NC(=O)c2ccccc2NC(=O)CN2CCCN(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C29H34N4O3/c1-2-36-25-15-13-24(14-16-25)30-29(35)26-11-6-7-12-27(26)31-28(34)22-33-18-8-17-32(19-20-33)21-23-9-4-3-5-10-23/h3-7,9-16H,2,8,17-22H2,1H3,(H,30,35)(H,31,34) |
| InChIKey | TZSXHIAHBWMPHW-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.62 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |