C17H25ClN4O2 — CID 78903847
N-(5-chloro-2-pyridinyl)-1-[2-(diethylamino)-2-oxoethyl]piperidine-4-carboxamide (PubChem CID 78903847) has the molecular formula C17H25ClN4O2 and a molecular weight of 352.87 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-1-[2-(diethylamino)-2-oxoethyl]piperidine-4-carboxamide.
| Compound Name | N-(5-chloro-2-pyridinyl)-1-[2-(diethylamino)-2-oxoethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 78903847 |
| Molecular Formula | C17H25ClN4O2 |
| Molecular Weight | 352.87 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-1-[2-(diethylamino)-2-oxoethyl]piperidine-4-carboxamide |
| SMILES | CCN(CC)C(=O)CN1CCC(C(=O)Nc2ccc(Cl)cn2)CC1 |
| InChI | InChI=1S/C17H25ClN4O2/c1-3-22(4-2)16(23)12-21-9-7-13(8-10-21)17(24)20-15-6-5-14(18)11-19-15/h5-6,11,13H,3-4,7-10,12H2,1-2H3,(H,19,20,24) |
| InChIKey | DGSITTZOWLRFAR-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.87 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |