C17H24N2OS — CID 51945547
(3R,5S)-3,5-dimethyl-N-(2-prop-2-enylsulfanylphenyl)piperidine-1-carboxamide (PubChem CID 51945547) has the molecular formula C17H24N2OS and a molecular weight of 304.46 g/mol. Its IUPAC name is (3R,5S)-3,5-dimethyl-N-(2-prop-2-enylsulfanylphenyl)piperidine-1-carboxamide.
| Compound Name | (3R,5S)-3,5-dimethyl-N-(2-prop-2-enylsulfanylphenyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 51945547 |
| Molecular Formula | C17H24N2OS |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | (3R,5S)-3,5-dimethyl-N-(2-prop-2-enylsulfanylphenyl)piperidine-1-carboxamide |
| SMILES | C=CCSc1ccccc1NC(=O)N1C[C@H](C)C[C@H](C)C1 |
| InChI | InChI=1S/C17H24N2OS/c1-4-9-21-16-8-6-5-7-15(16)18-17(20)19-11-13(2)10-14(3)12-19/h4-8,13-14H,1,9-12H2,2-3H3,(H,18,20)/t13-,14+ |
| InChIKey | XSAHBTZBVZRIJF-OKILXGFUSA-N |
| XLogP | 4.47 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|