C12H15NO2S — CID 60661108
ethyl N-(2-prop-2-enylsulfanylphenyl)carbamate (PubChem CID 60661108) has the molecular formula C12H15NO2S and a molecular weight of 237.32 g/mol. Its IUPAC name is ethyl N-(2-prop-2-enylsulfanylphenyl)carbamate.
| Compound Name | ethyl N-(2-prop-2-enylsulfanylphenyl)carbamate |
|---|---|
| PubChem CID | 60661108 |
| Molecular Formula | C12H15NO2S |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | ethyl N-(2-prop-2-enylsulfanylphenyl)carbamate |
| SMILES | C=CCSc1ccccc1NC(=O)OCC |
| InChI | InChI=1S/C12H15NO2S/c1-3-9-16-11-8-6-5-7-10(11)13-12(14)15-4-2/h3,5-8H,1,4,9H2,2H3,(H,13,14) |
| InChIKey | ZQXYBUBODMMPPN-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|