C17H16BrNOS — CID 104851985
3-bromo-5-methyl-N-(2-prop-2-enylsulfanylphenyl)benzamide (PubChem CID 104851985) has the molecular formula C17H16BrNOS and a molecular weight of 362.29 g/mol. Its IUPAC name is 3-bromo-5-methyl-N-(2-prop-2-enylsulfanylphenyl)benzamide.
| Compound Name | 3-bromo-5-methyl-N-(2-prop-2-enylsulfanylphenyl)benzamide |
|---|---|
| PubChem CID | 104851985 |
| Molecular Formula | C17H16BrNOS |
| Molecular Weight | 362.29 g/mol |
| Exact Mass | 361.01 |
| IUPAC Name | 3-bromo-5-methyl-N-(2-prop-2-enylsulfanylphenyl)benzamide |
| SMILES | C=CCSc1ccccc1NC(=O)c1cc(C)cc(Br)c1 |
| InChI | InChI=1S/C17H16BrNOS/c1-3-8-21-16-7-5-4-6-15(16)19-17(20)13-9-12(2)10-14(18)11-13/h3-7,9-11H,1,8H2,2H3,(H,19,20) |
| InChIKey | UYCKCMLIZGTPJJ-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.29 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|