C20H20N2OS — CID 46636880
2,3-dimethyl-N-(2-prop-2-enylsulfanylphenyl)-1H-indole-5-carboxamide (PubChem CID 46636880) has the molecular formula C20H20N2OS and a molecular weight of 336.46 g/mol. Its IUPAC name is 2,3-dimethyl-N-(2-prop-2-enylsulfanylphenyl)-1H-indole-5-carboxamide.
| Compound Name | 2,3-dimethyl-N-(2-prop-2-enylsulfanylphenyl)-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 46636880 |
| Molecular Formula | C20H20N2OS |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 2,3-dimethyl-N-(2-prop-2-enylsulfanylphenyl)-1H-indole-5-carboxamide |
| SMILES | C=CCSc1ccccc1NC(=O)c1ccc2[nH]c(C)c(C)c2c1 |
| InChI | InChI=1S/C20H20N2OS/c1-4-11-24-19-8-6-5-7-18(19)22-20(23)15-9-10-17-16(12-15)13(2)14(3)21-17/h4-10,12,21H,1,11H2,2-3H3,(H,22,23) |
| InChIKey | WBICQQFWJUBFKP-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|