C16H13BrClNOS — CID 81296027
4-bromo-3-chloro-N-(2-prop-2-enylsulfanylphenyl)benzamide (PubChem CID 81296027) has the molecular formula C16H13BrClNOS and a molecular weight of 382.71 g/mol. Its IUPAC name is 4-bromo-3-chloro-N-(2-prop-2-enylsulfanylphenyl)benzamide.
| Compound Name | 4-bromo-3-chloro-N-(2-prop-2-enylsulfanylphenyl)benzamide |
|---|---|
| PubChem CID | 81296027 |
| Molecular Formula | C16H13BrClNOS |
| Molecular Weight | 382.71 g/mol |
| Exact Mass | 380.96 |
| IUPAC Name | 4-bromo-3-chloro-N-(2-prop-2-enylsulfanylphenyl)benzamide |
| SMILES | C=CCSc1ccccc1NC(=O)c1ccc(Br)c(Cl)c1 |
| InChI | InChI=1S/C16H13BrClNOS/c1-2-9-21-15-6-4-3-5-14(15)19-16(20)11-7-8-12(17)13(18)10-11/h2-8,10H,1,9H2,(H,19,20) |
| InChIKey | MAPWOFDWJKDNAE-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.71 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|