C21H18N2O3S — CID 26813748
N-[4-[(2-prop-2-enylsulfanylphenyl)carbamoyl]phenyl]furan-2-carboxamide (PubChem CID 26813748) has the molecular formula C21H18N2O3S and a molecular weight of 378.45 g/mol. Its IUPAC name is N-[4-[(2-prop-2-enylsulfanylphenyl)carbamoyl]phenyl]furan-2-carboxamide.
| Compound Name | N-[4-[(2-prop-2-enylsulfanylphenyl)carbamoyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 26813748 |
| Molecular Formula | C21H18N2O3S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | N-[4-[(2-prop-2-enylsulfanylphenyl)carbamoyl]phenyl]furan-2-carboxamide |
| SMILES | C=CCSc1ccccc1NC(=O)c1ccc(NC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C21H18N2O3S/c1-2-14-27-19-8-4-3-6-17(19)23-20(24)15-9-11-16(12-10-15)22-21(25)18-7-5-13-26-18/h2-13H,1,14H2,(H,22,25)(H,23,24) |
| InChIKey | XMWATTRBWWBSFA-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|