C26H22N2O3 — CID 9450262
N-[4-(2,2-diphenylethylcarbamoyl)phenyl]furan-2-carboxamide (PubChem CID 9450262) has the molecular formula C26H22N2O3 and a molecular weight of 410.47 g/mol. Its IUPAC name is N-[4-(2,2-diphenylethylcarbamoyl)phenyl]furan-2-carboxamide.
| Compound Name | N-[4-(2,2-diphenylethylcarbamoyl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 9450262 |
| Molecular Formula | C26H22N2O3 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | N-[4-(2,2-diphenylethylcarbamoyl)phenyl]furan-2-carboxamide |
| SMILES | O=C(NCC(c1ccccc1)c1ccccc1)c1ccc(NC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C26H22N2O3/c29-25(21-13-15-22(16-14-21)28-26(30)24-12-7-17-31-24)27-18-23(19-8-3-1-4-9-19)20-10-5-2-6-11-20/h1-17,23H,18H2,(H,27,29)(H,28,30) |
| InChIKey | SIUNFSILKKCMQO-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |