C22H24N3O3+ — CID 8937893
[(2S)-2-[[4-(furan-2-carbonylamino)benzoyl]amino]-2-phenylethyl]-dimethylazanium (PubChem CID 8937893) has the molecular formula C22H24N3O3+ and a molecular weight of 378.45 g/mol. Its IUPAC name is [(2S)-2-[[4-(furan-2-carbonylamino)benzoyl]amino]-2-phenylethyl]-dimethylazanium.
| Compound Name | [(2S)-2-[[4-(furan-2-carbonylamino)benzoyl]amino]-2-phenylethyl]-dimethylazanium |
|---|---|
| PubChem CID | 8937893 |
| Molecular Formula | C22H24N3O3+ |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | [(2S)-2-[[4-(furan-2-carbonylamino)benzoyl]amino]-2-phenylethyl]-dimethylazanium |
| SMILES | C[NH+](C)C[C@@H](NC(=O)c1ccc(NC(=O)c2ccco2)cc1)c1ccccc1 |
| InChI | InChI=1S/C22H23N3O3/c1-25(2)15-19(16-7-4-3-5-8-16)24-21(26)17-10-12-18(13-11-17)23-22(27)20-9-6-14-28-20/h3-14,19H,15H2,1-2H3,(H,23,27)(H,24,26)/p+1/t19-/m1/s1 |
| InChIKey | YGIQUZPSDQPPOL-LJQANCHMSA-O |
| XLogP | 2.15 |
| TPSA | 75.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |