C25H20N2O3 — CID 2286846
N-[4-[(2,2-diphenylacetyl)amino]phenyl]furan-2-carboxamide (PubChem CID 2286846) has the molecular formula C25H20N2O3 and a molecular weight of 396.45 g/mol. Its IUPAC name is N-[4-[(2,2-diphenylacetyl)amino]phenyl]furan-2-carboxamide.
| Compound Name | N-[4-[(2,2-diphenylacetyl)amino]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 2286846 |
| Molecular Formula | C25H20N2O3 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | N-[4-[(2,2-diphenylacetyl)amino]phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(NC(=O)C(c2ccccc2)c2ccccc2)cc1)c1ccco1 |
| InChI | InChI=1S/C25H20N2O3/c28-24(22-12-7-17-30-22)26-20-13-15-21(16-14-20)27-25(29)23(18-8-3-1-4-9-18)19-10-5-2-6-11-19/h1-17,23H,(H,26,28)(H,27,29) |
| InChIKey | BKLAWVCSFFOKQR-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |